C30H36P+ — CID 102504264
[(2E)-5,9-dimethyldeca-2,8-dienyl]-triphenylphosphanium (PubChem CID 102504264) has the molecular formula C30H36P+ and a molecular weight of 427.59 g/mol. Its IUPAC name is [(2E)-5,9-dimethyldeca-2,8-dienyl]-triphenylphosphanium.
| Compound Name | [(2E)-5,9-dimethyldeca-2,8-dienyl]-triphenylphosphanium |
|---|---|
| PubChem CID | 102504264 |
| Molecular Formula | C30H36P+ |
| Molecular Weight | 427.59 g/mol |
| Exact Mass | 427.25 |
| IUPAC Name | [(2E)-5,9-dimethyldeca-2,8-dienyl]-triphenylphosphanium |
| SMILES | CC(C)=CCCC(C)C/C=C/C[P+](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H36P/c1-26(2)16-15-18-27(3)17-13-14-25-31(28-19-7-4-8-20-28,29-21-9-5-10-22-29)30-23-11-6-12-24-30/h4-14,16,19-24,27H,15,17-18,25H2,1-3H3/q+1/b14-13+ |
| InChIKey | SBFQAQPRYFVWQB-BUHFOSPRSA-N |
| XLogP | 7.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.59 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|