C30H38P+ — CID 101160333
triphenyl-[(E)-6,8,8-trimethylnon-3-enyl]phosphanium (PubChem CID 101160333) has the molecular formula C30H38P+ and a molecular weight of 429.61 g/mol. Its IUPAC name is triphenyl-[(E)-6,8,8-trimethylnon-3-enyl]phosphanium.
| Compound Name | triphenyl-[(E)-6,8,8-trimethylnon-3-enyl]phosphanium |
|---|---|
| PubChem CID | 101160333 |
| Molecular Formula | C30H38P+ |
| Molecular Weight | 429.61 g/mol |
| Exact Mass | 429.27 |
| IUPAC Name | triphenyl-[(E)-6,8,8-trimethylnon-3-enyl]phosphanium |
| SMILES | CC(C/C=C/CC[P+](c1ccccc1)(c1ccccc1)c1ccccc1)CC(C)(C)C |
| InChI | InChI=1S/C30H38P/c1-26(25-30(2,3)4)17-9-8-16-24-31(27-18-10-5-11-19-27,28-20-12-6-13-21-28)29-22-14-7-15-23-29/h5-15,18-23,26H,16-17,24-25H2,1-4H3/q+1/b9-8+ |
| InChIKey | AJMRYLMJKGBRFS-CMDGGOBGSA-N |
| XLogP | 7.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.61 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|