C24H28BrP — CID 71363385
3,3-dimethylbutyl(triphenyl)phosphanium bromide (PubChem CID 71363385) has the molecular formula C24H28BrP and a molecular weight of 427.37 g/mol. Its IUPAC name is 3,3-dimethylbutyl(triphenyl)phosphanium bromide.
| Compound Name | 3,3-dimethylbutyl(triphenyl)phosphanium bromide |
|---|---|
| PubChem CID | 71363385 |
| Molecular Formula | C24H28BrP |
| Molecular Weight | 427.37 g/mol |
| Exact Mass | 426.11 |
| IUPAC Name | 3,3-dimethylbutyl(triphenyl)phosphanium bromide |
| SMILES | CC(C)(C)CC[P+](c1ccccc1)(c1ccccc1)c1ccccc1.[Br-] |
| InChI | InChI=1S/C24H28P.BrH/c1-24(2,3)19-20-25(21-13-7-4-8-14-21,22-15-9-5-10-16-22)23-17-11-6-12-18-23;/h4-18H,19-20H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | RUVWUZMXNOEIFX-UHFFFAOYSA-M |
| XLogP | 2.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.37 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|