C27H32O2P+ — CID 59411838
(4-carboxy-3,3,4-trimethylpentyl)-triphenylphosphanium (PubChem CID 59411838) has the molecular formula C27H32O2P+ and a molecular weight of 419.53 g/mol. Its IUPAC name is (4-carboxy-3,3,4-trimethylpentyl)-triphenylphosphanium.
| Compound Name | (4-carboxy-3,3,4-trimethylpentyl)-triphenylphosphanium |
|---|---|
| PubChem CID | 59411838 |
| Molecular Formula | C27H32O2P+ |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | (4-carboxy-3,3,4-trimethylpentyl)-triphenylphosphanium |
| SMILES | CC(C)(CC[P+](c1ccccc1)(c1ccccc1)c1ccccc1)C(C)(C)C(=O)O |
| InChI | InChI=1S/C27H31O2P/c1-26(2,27(3,4)25(28)29)20-21-30(22-14-8-5-9-15-22,23-16-10-6-11-17-23)24-18-12-7-13-19-24/h5-19H,20-21H2,1-4H3/p+1 |
| InChIKey | LMDKHBODSKLBNN-UHFFFAOYSA-O |
| XLogP | 5.51 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|