C28H34OP+ — CID 134400894
triphenyl-(2,2,4,4-tetramethyl-5-oxohexyl)phosphanium (PubChem CID 134400894) has the molecular formula C28H34OP+ and a molecular weight of 417.55 g/mol. Its IUPAC name is triphenyl-(2,2,4,4-tetramethyl-5-oxohexyl)phosphanium.
| Compound Name | triphenyl-(2,2,4,4-tetramethyl-5-oxohexyl)phosphanium |
|---|---|
| PubChem CID | 134400894 |
| Molecular Formula | C28H34OP+ |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.23 |
| IUPAC Name | triphenyl-(2,2,4,4-tetramethyl-5-oxohexyl)phosphanium |
| SMILES | CC(=O)C(C)(C)CC(C)(C)C[P+](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H34OP/c1-23(29)28(4,5)21-27(2,3)22-30(24-15-9-6-10-16-24,25-17-11-7-12-18-25)26-19-13-8-14-20-26/h6-20H,21-22H2,1-5H3/q+1 |
| InChIKey | YKEDEPQFGIWIRD-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|