C25H29OP — CID 90841990
3,3-dimethylpentan-2-one;triphenylphosphane (PubChem CID 90841990) has the molecular formula C25H29OP and a molecular weight of 376.48 g/mol. Its IUPAC name is 3,3-dimethylpentan-2-one;triphenylphosphane.
| Compound Name | 3,3-dimethylpentan-2-one;triphenylphosphane |
|---|---|
| PubChem CID | 90841990 |
| Molecular Formula | C25H29OP |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | 3,3-dimethylpentan-2-one;triphenylphosphane |
| SMILES | CCC(C)(C)C(C)=O.c1ccc(P(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15P.C7H14O/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-5-7(3,4)6(2)8/h1-15H;5H2,1-4H3 |
| InChIKey | IYSYCFFBTMMBIW-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|