About 2,2-dimethylpropane;triphenylphosphane
2,2-dimethylpropane;triphenylphosphane (PubChem CID 143924519) has the molecular formula C23H27P
and a molecular weight of 334.44 g/mol. Its IUPAC name is 2,2-dimethylpropane;triphenylphosphane.
Molecular Properties
| Compound Name | 2,2-dimethylpropane;triphenylphosphane |
| PubChem CID | 143924519 |
| Molecular Formula | C23H27P |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | 2,2-dimethylpropane;triphenylphosphane |
| SMILES | CC(C)(C)C.c1ccc(P(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15P.C5H12/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-5(2,3)4/h1-15H;1-4H3 |
| InChIKey | VPCSKQKOLOONCC-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dimethylpropane;triphenylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethylpropane;triphenylphosphane?
The IUPAC name of 2,2-dimethylpropane;triphenylphosphane (CID 143924519) is 2,2-dimethylpropane;triphenylphosphane.
What is the SMILES notation for 2,2-dimethylpropane;triphenylphosphane?
The canonical SMILES for 2,2-dimethylpropane;triphenylphosphane is CC(C)(C)C.c1ccc(P(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of 2,2-dimethylpropane;triphenylphosphane?
The InChIKey is VPCSKQKOLOONCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15P.C5H12/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-5(2,3)4/h1-15H;1-4H3.
What are the key properties of 2,2-dimethylpropane;triphenylphosphane?
2,2-dimethylpropane;triphenylphosphane has a molecular weight of 334.44 g/mol, XLogP of 5.50, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethylpropane;triphenylphosphane is sourced from PubChem (CID 143924519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).