C12H17ClOS — CID 19864092
chlorobenzene;3,3-dimethyl-4-sulfanylbutan-2-one (PubChem CID 19864092) has the molecular formula C12H17ClOS and a molecular weight of 244.79 g/mol. Its IUPAC name is chlorobenzene;3,3-dimethyl-4-sulfanylbutan-2-one.
| Compound Name | chlorobenzene;3,3-dimethyl-4-sulfanylbutan-2-one |
|---|---|
| PubChem CID | 19864092 |
| Molecular Formula | C12H17ClOS |
| Molecular Weight | 244.79 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | chlorobenzene;3,3-dimethyl-4-sulfanylbutan-2-one |
| SMILES | CC(=O)C(C)(C)CS.Clc1ccccc1 |
| InChI | InChI=1S/C6H5Cl.C6H12OS/c7-6-4-2-1-3-5-6;1-5(7)6(2,3)4-8/h1-5H;8H,4H2,1-3H3 |
| InChIKey | HMBIQHQBRCSWQM-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 17.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.79 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|