C15H19ClN2OS — CID 19864090
chlorobenzene;1-imidazol-1-yl-3,3-dimethyl-4-sulfanylbutan-2-one (PubChem CID 19864090) has the molecular formula C15H19ClN2OS and a molecular weight of 310.85 g/mol. Its IUPAC name is chlorobenzene;1-imidazol-1-yl-3,3-dimethyl-4-sulfanylbutan-2-one.
| Compound Name | chlorobenzene;1-imidazol-1-yl-3,3-dimethyl-4-sulfanylbutan-2-one |
|---|---|
| PubChem CID | 19864090 |
| Molecular Formula | C15H19ClN2OS |
| Molecular Weight | 310.85 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | chlorobenzene;1-imidazol-1-yl-3,3-dimethyl-4-sulfanylbutan-2-one |
| SMILES | CC(C)(CS)C(=O)Cn1ccnc1.Clc1ccccc1 |
| InChI | InChI=1S/C9H14N2OS.C6H5Cl/c1-9(2,6-13)8(12)5-11-4-3-10-7-11;7-6-4-2-1-3-5-6/h3-4,7,13H,5-6H2,1-2H3;1-5H |
| InChIKey | KSHPCHIKKDLVBW-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 34.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.85 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|