C13H22N2O — CID 13269102
1-imidazol-1-yl-3,3,5,5-tetramethylhexan-2-one (PubChem CID 13269102) has the molecular formula C13H22N2O and a molecular weight of 222.33 g/mol. Its IUPAC name is 1-imidazol-1-yl-3,3,5,5-tetramethylhexan-2-one.
| Compound Name | 1-imidazol-1-yl-3,3,5,5-tetramethylhexan-2-one |
|---|---|
| PubChem CID | 13269102 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | 1-imidazol-1-yl-3,3,5,5-tetramethylhexan-2-one |
| SMILES | CC(C)(C)CC(C)(C)C(=O)Cn1ccnc1 |
| InChI | InChI=1S/C13H22N2O/c1-12(2,3)9-13(4,5)11(16)8-15-7-6-14-10-15/h6-7,10H,8-9H2,1-5H3 |
| InChIKey | UBIKBHCJXHJVBU-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |