C7H13N3O — CID 177063999
N-ethyl-2-imidazol-1-ylacetamide;molecular hydrogen (PubChem CID 177063999) has the molecular formula C7H13N3O and a molecular weight of 155.20 g/mol. Its IUPAC name is N-ethyl-2-imidazol-1-ylacetamide;molecular hydrogen.
| Compound Name | N-ethyl-2-imidazol-1-ylacetamide;molecular hydrogen |
|---|---|
| PubChem CID | 177063999 |
| Molecular Formula | C7H13N3O |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.11 |
| IUPAC Name | N-ethyl-2-imidazol-1-ylacetamide;molecular hydrogen |
| SMILES | CCNC(=O)Cn1ccnc1.[H][H] |
| InChI | InChI=1S/C7H11N3O.H2/c1-2-9-7(11)5-10-4-3-8-6-10;/h3-4,6H,2,5H2,1H3,(H,9,11);1H |
| InChIKey | HVNJEIABVKZVDB-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |