About ethane;3-imidazol-1-ylpropanoic acid
ethane;3-imidazol-1-ylpropanoic acid (PubChem CID 169203734) has the molecular formula C8H14N2O2
and a molecular weight of 170.21 g/mol. Its IUPAC name is ethane;3-imidazol-1-ylpropanoic acid.
Molecular Properties
| Compound Name | ethane;3-imidazol-1-ylpropanoic acid |
| PubChem CID | 169203734 |
| Molecular Formula | C8H14N2O2 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | ethane;3-imidazol-1-ylpropanoic acid |
| SMILES | CC.O=C(O)CCn1ccnc1 |
| InChI | InChI=1S/C6H8N2O2.C2H6/c9-6(10)1-3-8-4-2-7-5-8;1-2/h2,4-5H,1,3H2,(H,9,10);1-2H3 |
| InChIKey | CURXKHQEQKJLHF-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;3-imidazol-1-ylpropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-imidazol-1-ylpropanoic acid?
The IUPAC name of ethane;3-imidazol-1-ylpropanoic acid (CID 169203734) is ethane;3-imidazol-1-ylpropanoic acid.
What is the SMILES notation for ethane;3-imidazol-1-ylpropanoic acid?
The canonical SMILES for ethane;3-imidazol-1-ylpropanoic acid is CC.O=C(O)CCn1ccnc1.
What is the InChIKey of ethane;3-imidazol-1-ylpropanoic acid?
The InChIKey is CURXKHQEQKJLHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O2.C2H6/c9-6(10)1-3-8-4-2-7-5-8;1-2/h2,4-5H,1,3H2,(H,9,10);1-2H3.
What are the key properties of ethane;3-imidazol-1-ylpropanoic acid?
ethane;3-imidazol-1-ylpropanoic acid has a molecular weight of 170.21 g/mol, XLogP of 1.38, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-imidazol-1-ylpropanoic acid is sourced from PubChem (CID 169203734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).