About 3-imidazol-1-ylpropanoyl chloride
3-imidazol-1-ylpropanoyl chloride (PubChem CID 19872160) has the molecular formula C6H7ClN2O
and a molecular weight of 158.59 g/mol. Its IUPAC name is 3-imidazol-1-ylpropanoyl chloride.
Molecular Properties
| Compound Name | 3-imidazol-1-ylpropanoyl chloride |
| PubChem CID | 19872160 |
| Molecular Formula | C6H7ClN2O |
| Molecular Weight | 158.59 g/mol |
| Exact Mass | 158.02 |
| IUPAC Name | 3-imidazol-1-ylpropanoyl chloride |
| SMILES | O=C(Cl)CCn1ccnc1 |
| InChI | InChI=1S/C6H7ClN2O/c7-6(10)1-3-9-4-2-8-5-9/h2,4-5H,1,3H2 |
| InChIKey | JCEJOXVNPHBVNK-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.59 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-imidazol-1-ylpropanoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-imidazol-1-ylpropanoyl chloride?
The IUPAC name of 3-imidazol-1-ylpropanoyl chloride (CID 19872160) is 3-imidazol-1-ylpropanoyl chloride.
What is the SMILES notation for 3-imidazol-1-ylpropanoyl chloride?
The canonical SMILES for 3-imidazol-1-ylpropanoyl chloride is O=C(Cl)CCn1ccnc1.
What is the InChIKey of 3-imidazol-1-ylpropanoyl chloride?
The InChIKey is JCEJOXVNPHBVNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7ClN2O/c7-6(10)1-3-9-4-2-8-5-9/h2,4-5H,1,3H2.
What are the key properties of 3-imidazol-1-ylpropanoyl chloride?
3-imidazol-1-ylpropanoyl chloride has a molecular weight of 158.59 g/mol, XLogP of 1.04, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-imidazol-1-ylpropanoyl chloride is sourced from PubChem (CID 19872160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).