3-imidazol-1-ylpropanoyl chloride

C6H7ClN2O — CID 19872160

IUPAC3-imidazol-1-ylpropanoyl chloride
SMILESO=C(Cl)CCn1ccnc1
InChIInChI=1S/C6H7ClN2O/c7-6(10)1-3-9-4-2-8-5-9/h2,4-5H,1,3H2
InChIKeyJCEJOXVNPHBVNK-UHFFFAOYSA-N
MW158.59 g/mol
LogP1.04
Rot. Bonds3

About 3-imidazol-1-ylpropanoyl chloride

3-imidazol-1-ylpropanoyl chloride (PubChem CID 19872160) has the molecular formula C6H7ClN2O and a molecular weight of 158.59 g/mol. Its IUPAC name is 3-imidazol-1-ylpropanoyl chloride.

Molecular Properties

Compound Name3-imidazol-1-ylpropanoyl chloride
PubChem CID19872160
Molecular FormulaC6H7ClN2O
Molecular Weight158.59 g/mol
Exact Mass158.02
IUPAC Name3-imidazol-1-ylpropanoyl chloride
SMILESO=C(Cl)CCn1ccnc1
InChIInChI=1S/C6H7ClN2O/c7-6(10)1-3-9-4-2-8-5-9/h2,4-5H,1,3H2
InChIKeyJCEJOXVNPHBVNK-UHFFFAOYSA-N
XLogP1.04
TPSA34.89 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500158.59
LogP ≤ 51.04
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze 3-imidazol-1-ylpropanoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-imidazol-1-ylpropanoyl chloride?
The IUPAC name of 3-imidazol-1-ylpropanoyl chloride (CID 19872160) is 3-imidazol-1-ylpropanoyl chloride.
What is the SMILES notation for 3-imidazol-1-ylpropanoyl chloride?
The canonical SMILES for 3-imidazol-1-ylpropanoyl chloride is O=C(Cl)CCn1ccnc1.
What is the InChIKey of 3-imidazol-1-ylpropanoyl chloride?
The InChIKey is JCEJOXVNPHBVNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7ClN2O/c7-6(10)1-3-9-4-2-8-5-9/h2,4-5H,1,3H2.
What are the key properties of 3-imidazol-1-ylpropanoyl chloride?
3-imidazol-1-ylpropanoyl chloride has a molecular weight of 158.59 g/mol, XLogP of 1.04, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-imidazol-1-ylpropanoyl chloride is sourced from PubChem (CID 19872160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).