C13H23ClN2O2 — CID 12870498
8-imidazol-1-yl-4,4-dimethyloctanoic acid;hydrochloride (PubChem CID 12870498) has the molecular formula C13H23ClN2O2 and a molecular weight of 274.79 g/mol. Its IUPAC name is 8-imidazol-1-yl-4,4-dimethyloctanoic acid;hydrochloride.
| Compound Name | 8-imidazol-1-yl-4,4-dimethyloctanoic acid;hydrochloride |
|---|---|
| PubChem CID | 12870498 |
| Molecular Formula | C13H23ClN2O2 |
| Molecular Weight | 274.79 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | 8-imidazol-1-yl-4,4-dimethyloctanoic acid;hydrochloride |
| SMILES | CC(C)(CCCCn1ccnc1)CCC(=O)O.Cl |
| InChI | InChI=1S/C13H22N2O2.ClH/c1-13(2,7-5-12(16)17)6-3-4-9-15-10-8-14-11-15;/h8,10-11H,3-7,9H2,1-2H3,(H,16,17);1H |
| InChIKey | LIMRGGZIPWOMLG-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.79 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|