C15H19N3O4 — CID 36795698
2-imidazol-1-yl-N-[(2,4,5-trimethoxyphenyl)methyl]acetamide (PubChem CID 36795698) has the molecular formula C15H19N3O4 and a molecular weight of 305.33 g/mol. Its IUPAC name is 2-imidazol-1-yl-N-[(2,4,5-trimethoxyphenyl)methyl]acetamide.
| Compound Name | 2-imidazol-1-yl-N-[(2,4,5-trimethoxyphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 36795698 |
| Molecular Formula | C15H19N3O4 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | 2-imidazol-1-yl-N-[(2,4,5-trimethoxyphenyl)methyl]acetamide |
| SMILES | COc1cc(OC)c(OC)cc1CNC(=O)Cn1ccnc1 |
| InChI | InChI=1S/C15H19N3O4/c1-20-12-7-14(22-3)13(21-2)6-11(12)8-17-15(19)9-18-5-4-16-10-18/h4-7,10H,8-9H2,1-3H3,(H,17,19) |
| InChIKey | HVYIUFWTANJCAV-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |