C21H24N4O4 — CID 55472347
1-[[2-(imidazol-1-ylmethyl)phenyl]methyl]-3-(3,4,5-trimethoxyphenyl)urea (PubChem CID 55472347) has the molecular formula C21H24N4O4 and a molecular weight of 396.45 g/mol. Its IUPAC name is 1-[[2-(imidazol-1-ylmethyl)phenyl]methyl]-3-(3,4,5-trimethoxyphenyl)urea.
| Compound Name | 1-[[2-(imidazol-1-ylmethyl)phenyl]methyl]-3-(3,4,5-trimethoxyphenyl)urea |
|---|---|
| PubChem CID | 55472347 |
| Molecular Formula | C21H24N4O4 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | 1-[[2-(imidazol-1-ylmethyl)phenyl]methyl]-3-(3,4,5-trimethoxyphenyl)urea |
| SMILES | COc1cc(NC(=O)NCc2ccccc2Cn2ccnc2)cc(OC)c1OC |
| InChI | InChI=1S/C21H24N4O4/c1-27-18-10-17(11-19(28-2)20(18)29-3)24-21(26)23-12-15-6-4-5-7-16(15)13-25-9-8-22-14-25/h4-11,14H,12-13H2,1-3H3,(H2,23,24,26) |
| InChIKey | KUAHYNLOJMZQEQ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 86.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |