C20H22N4O5 — CID 71779482
1-[(3-methyl-4-oxophthalazin-1-yl)methyl]-3-(3,4,5-trimethoxyphenyl)urea (PubChem CID 71779482) has the molecular formula C20H22N4O5 and a molecular weight of 398.42 g/mol. Its IUPAC name is 1-[(3-methyl-4-oxophthalazin-1-yl)methyl]-3-(3,4,5-trimethoxyphenyl)urea.
| Compound Name | 1-[(3-methyl-4-oxophthalazin-1-yl)methyl]-3-(3,4,5-trimethoxyphenyl)urea |
|---|---|
| PubChem CID | 71779482 |
| Molecular Formula | C20H22N4O5 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | 1-[(3-methyl-4-oxophthalazin-1-yl)methyl]-3-(3,4,5-trimethoxyphenyl)urea |
| SMILES | COc1cc(NC(=O)NCc2nn(C)c(=O)c3ccccc23)cc(OC)c1OC |
| InChI | InChI=1S/C20H22N4O5/c1-24-19(25)14-8-6-5-7-13(14)15(23-24)11-21-20(26)22-12-9-16(27-2)18(29-4)17(10-12)28-3/h5-10H,11H2,1-4H3,(H2,21,22,26) |
| InChIKey | RUSBVHOJPPAZJI-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 103.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |