C22H22N4O5 — CID 121049064
1-[(4-oxo-3-prop-2-ynylphthalazin-1-yl)methyl]-3-(3,4,5-trimethoxyphenyl)urea (PubChem CID 121049064) has the molecular formula C22H22N4O5 and a molecular weight of 422.44 g/mol. Its IUPAC name is 1-[(4-oxo-3-prop-2-ynylphthalazin-1-yl)methyl]-3-(3,4,5-trimethoxyphenyl)urea.
| Compound Name | 1-[(4-oxo-3-prop-2-ynylphthalazin-1-yl)methyl]-3-(3,4,5-trimethoxyphenyl)urea |
|---|---|
| PubChem CID | 121049064 |
| Molecular Formula | C22H22N4O5 |
| Molecular Weight | 422.44 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | 1-[(4-oxo-3-prop-2-ynylphthalazin-1-yl)methyl]-3-(3,4,5-trimethoxyphenyl)urea |
| SMILES | C#CCn1nc(CNC(=O)Nc2cc(OC)c(OC)c(OC)c2)c2ccccc2c1=O |
| InChI | InChI=1S/C22H22N4O5/c1-5-10-26-21(27)16-9-7-6-8-15(16)17(25-26)13-23-22(28)24-14-11-18(29-2)20(31-4)19(12-14)30-3/h1,6-9,11-12H,10,13H2,2-4H3,(H2,23,24,28) |
| InChIKey | MTUUVORRDUEZDE-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 103.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.44 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|