C22H21N3O4 — CID 121048942
2-(3,4-dimethoxyphenyl)-N-[(4-oxo-3-prop-2-ynylphthalazin-1-yl)methyl]acetamide (PubChem CID 121048942) has the molecular formula C22H21N3O4 and a molecular weight of 391.43 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-N-[(4-oxo-3-prop-2-ynylphthalazin-1-yl)methyl]acetamide.
| Compound Name | 2-(3,4-dimethoxyphenyl)-N-[(4-oxo-3-prop-2-ynylphthalazin-1-yl)methyl]acetamide |
|---|---|
| PubChem CID | 121048942 |
| Molecular Formula | C22H21N3O4 |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-N-[(4-oxo-3-prop-2-ynylphthalazin-1-yl)methyl]acetamide |
| SMILES | C#CCn1nc(CNC(=O)Cc2ccc(OC)c(OC)c2)c2ccccc2c1=O |
| InChI | InChI=1S/C22H21N3O4/c1-4-11-25-22(27)17-8-6-5-7-16(17)18(24-25)14-23-21(26)13-15-9-10-19(28-2)20(12-15)29-3/h1,5-10,12H,11,13-14H2,2-3H3,(H,23,26) |
| InChIKey | GSXHTSKPNIGPJE-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|