C19H15ClN4O2 — CID 121048770
1-(2-chlorophenyl)-3-[(4-oxo-3-prop-2-ynylphthalazin-1-yl)methyl]urea (PubChem CID 121048770) has the molecular formula C19H15ClN4O2 and a molecular weight of 366.81 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-3-[(4-oxo-3-prop-2-ynylphthalazin-1-yl)methyl]urea.
| Compound Name | 1-(2-chlorophenyl)-3-[(4-oxo-3-prop-2-ynylphthalazin-1-yl)methyl]urea |
|---|---|
| PubChem CID | 121048770 |
| Molecular Formula | C19H15ClN4O2 |
| Molecular Weight | 366.81 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | 1-(2-chlorophenyl)-3-[(4-oxo-3-prop-2-ynylphthalazin-1-yl)methyl]urea |
| SMILES | C#CCn1nc(CNC(=O)Nc2ccccc2Cl)c2ccccc2c1=O |
| InChI | InChI=1S/C19H15ClN4O2/c1-2-11-24-18(25)14-8-4-3-7-13(14)17(23-24)12-21-19(26)22-16-10-6-5-9-15(16)20/h1,3-10H,11-12H2,(H2,21,22,26) |
| InChIKey | NOILXILECIQPRQ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.81 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|