C17H14N4O2S — CID 121049062
1-[(4-oxo-3-prop-2-ynylphthalazin-1-yl)methyl]-3-thiophen-2-ylurea (PubChem CID 121049062) has the molecular formula C17H14N4O2S and a molecular weight of 338.39 g/mol. Its IUPAC name is 1-[(4-oxo-3-prop-2-ynylphthalazin-1-yl)methyl]-3-thiophen-2-ylurea.
| Compound Name | 1-[(4-oxo-3-prop-2-ynylphthalazin-1-yl)methyl]-3-thiophen-2-ylurea |
|---|---|
| PubChem CID | 121049062 |
| Molecular Formula | C17H14N4O2S |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | 1-[(4-oxo-3-prop-2-ynylphthalazin-1-yl)methyl]-3-thiophen-2-ylurea |
| SMILES | C#CCn1nc(CNC(=O)Nc2cccs2)c2ccccc2c1=O |
| InChI | InChI=1S/C17H14N4O2S/c1-2-9-21-16(22)13-7-4-3-6-12(13)14(20-21)11-18-17(23)19-15-8-5-10-24-15/h1,3-8,10H,9,11H2,(H2,18,19,23) |
| InChIKey | ZNWOYMPRNRCIEU-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|