C24H22ClN3O2 — CID 121048955
1-(4-chlorophenyl)-N-[(4-oxo-3-prop-2-ynylphthalazin-1-yl)methyl]cyclopentane-1-carboxamide (PubChem CID 121048955) has the molecular formula C24H22ClN3O2 and a molecular weight of 419.91 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-N-[(4-oxo-3-prop-2-ynylphthalazin-1-yl)methyl]cyclopentane-1-carboxamide.
| Compound Name | 1-(4-chlorophenyl)-N-[(4-oxo-3-prop-2-ynylphthalazin-1-yl)methyl]cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 121048955 |
| Molecular Formula | C24H22ClN3O2 |
| Molecular Weight | 419.91 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | 1-(4-chlorophenyl)-N-[(4-oxo-3-prop-2-ynylphthalazin-1-yl)methyl]cyclopentane-1-carboxamide |
| SMILES | C#CCn1nc(CNC(=O)C2(c3ccc(Cl)cc3)CCCC2)c2ccccc2c1=O |
| InChI | InChI=1S/C24H22ClN3O2/c1-2-15-28-22(29)20-8-4-3-7-19(20)21(27-28)16-26-23(30)24(13-5-6-14-24)17-9-11-18(25)12-10-17/h1,3-4,7-12H,5-6,13-16H2,(H,26,30) |
| InChIKey | OONJFLLQXZXVIL-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.91 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|