C17H19N3O3 — CID 121049046
tert-butyl N-[(4-oxo-3-prop-2-ynylphthalazin-1-yl)methyl]carbamate (PubChem CID 121049046) has the molecular formula C17H19N3O3 and a molecular weight of 313.36 g/mol. Its IUPAC name is tert-butyl N-[(4-oxo-3-prop-2-ynylphthalazin-1-yl)methyl]carbamate.
| Compound Name | tert-butyl N-[(4-oxo-3-prop-2-ynylphthalazin-1-yl)methyl]carbamate |
|---|---|
| PubChem CID | 121049046 |
| Molecular Formula | C17H19N3O3 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | tert-butyl N-[(4-oxo-3-prop-2-ynylphthalazin-1-yl)methyl]carbamate |
| SMILES | C#CCn1nc(CNC(=O)OC(C)(C)C)c2ccccc2c1=O |
| InChI | InChI=1S/C17H19N3O3/c1-5-10-20-15(21)13-9-7-6-8-12(13)14(19-20)11-18-16(22)23-17(2,3)4/h1,6-9H,10-11H2,2-4H3,(H,18,22) |
| InChIKey | QWUJZWIQUBLZAV-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|