C14H18IN3O2 — CID 138461102
tert-butyl N-[2-(3-iodoindazol-1-yl)ethyl]carbamate (PubChem CID 138461102) has the molecular formula C14H18IN3O2 and a molecular weight of 387.22 g/mol. Its IUPAC name is tert-butyl N-[2-(3-iodoindazol-1-yl)ethyl]carbamate.
| Compound Name | tert-butyl N-[2-(3-iodoindazol-1-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 138461102 |
| Molecular Formula | C14H18IN3O2 |
| Molecular Weight | 387.22 g/mol |
| Exact Mass | 387.04 |
| IUPAC Name | tert-butyl N-[2-(3-iodoindazol-1-yl)ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCn1nc(I)c2ccccc21 |
| InChI | InChI=1S/C14H18IN3O2/c1-14(2,3)20-13(19)16-8-9-18-11-7-5-4-6-10(11)12(15)17-18/h4-7H,8-9H2,1-3H3,(H,16,19) |
| InChIKey | NWYGXLRZVQOGCK-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.22 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|