C17H23N3O3 — CID 134499343
tert-butyl N-[2-[5-(hydroxymethyl)-4-phenylpyrazol-1-yl]ethyl]carbamate (PubChem CID 134499343) has the molecular formula C17H23N3O3 and a molecular weight of 317.39 g/mol. Its IUPAC name is tert-butyl N-[2-[5-(hydroxymethyl)-4-phenylpyrazol-1-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[5-(hydroxymethyl)-4-phenylpyrazol-1-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 134499343 |
| Molecular Formula | C17H23N3O3 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | tert-butyl N-[2-[5-(hydroxymethyl)-4-phenylpyrazol-1-yl]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCn1ncc(-c2ccccc2)c1CO |
| InChI | InChI=1S/C17H23N3O3/c1-17(2,3)23-16(22)18-9-10-20-15(12-21)14(11-19-20)13-7-5-4-6-8-13/h4-8,11,21H,9-10,12H2,1-3H3,(H,18,22) |
| InChIKey | XMECOHMBIZWVJE-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |