C16H21N3O4 — CID 174665759
[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]indazol-3-yl] acetate (PubChem CID 174665759) has the molecular formula C16H21N3O4 and a molecular weight of 319.36 g/mol. Its IUPAC name is [2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]indazol-3-yl] acetate.
| Compound Name | [2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]indazol-3-yl] acetate |
|---|---|
| PubChem CID | 174665759 |
| Molecular Formula | C16H21N3O4 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | [2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]indazol-3-yl] acetate |
| SMILES | CC(=O)Oc1c2ccccc2nn1CCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H21N3O4/c1-11(20)22-14-12-7-5-6-8-13(12)18-19(14)10-9-17-15(21)23-16(2,3)4/h5-8H,9-10H2,1-4H3,(H,17,21) |
| InChIKey | XTIULFPWWHNULO-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |