C33H39N5O4 — CID 86593416
tert-butyl N-[3-[formyl-[1-(2-hydroxyethyl)-5-(tritylamino)pyrazol-4-yl]amino]propyl]carbamate (PubChem CID 86593416) has the molecular formula C33H39N5O4 and a molecular weight of 569.71 g/mol. Its IUPAC name is tert-butyl N-[3-[formyl-[1-(2-hydroxyethyl)-5-(tritylamino)pyrazol-4-yl]amino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[formyl-[1-(2-hydroxyethyl)-5-(tritylamino)pyrazol-4-yl]amino]propyl]carbamate |
|---|---|
| PubChem CID | 86593416 |
| Molecular Formula | C33H39N5O4 |
| Molecular Weight | 569.71 g/mol |
| Exact Mass | 569.30 |
| IUPAC Name | tert-butyl N-[3-[formyl-[1-(2-hydroxyethyl)-5-(tritylamino)pyrazol-4-yl]amino]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCN(C=O)c1cnn(CCO)c1NC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H39N5O4/c1-32(2,3)42-31(41)34-20-13-21-37(25-40)29-24-35-38(22-23-39)30(29)36-33(26-14-7-4-8-15-26,27-16-9-5-10-17-27)28-18-11-6-12-19-28/h4-12,14-19,24-25,36,39H,13,20-23H2,1-3H3,(H,34,41) |
| InChIKey | QLQQDGYRZUPAAC-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 108.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.71 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|