C24H25N3O4 — CID 146265063
tert-butyl N-[2-oxo-2-[[6-(2-phenylphenoxy)-2-pyridinyl]amino]ethyl]carbamate (PubChem CID 146265063) has the molecular formula C24H25N3O4 and a molecular weight of 419.48 g/mol. Its IUPAC name is tert-butyl N-[2-oxo-2-[[6-(2-phenylphenoxy)-2-pyridinyl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-oxo-2-[[6-(2-phenylphenoxy)-2-pyridinyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 146265063 |
| Molecular Formula | C24H25N3O4 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | tert-butyl N-[2-oxo-2-[[6-(2-phenylphenoxy)-2-pyridinyl]amino]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(=O)Nc1cccc(Oc2ccccc2-c2ccccc2)n1 |
| InChI | InChI=1S/C24H25N3O4/c1-24(2,3)31-23(29)25-16-21(28)26-20-14-9-15-22(27-20)30-19-13-8-7-12-18(19)17-10-5-4-6-11-17/h4-15H,16H2,1-3H3,(H,25,29)(H,26,27,28) |
| InChIKey | WHYWJCAEZYFRDQ-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |