C28H40N4O4Si — CID 54577000
tert-butyl N-[3-[[4-[1-(2-trimethylsilylethoxymethyl)indazol-3-yl]benzoyl]amino]propyl]carbamate (PubChem CID 54577000) has the molecular formula C28H40N4O4Si and a molecular weight of 524.74 g/mol. Its IUPAC name is tert-butyl N-[3-[[4-[1-(2-trimethylsilylethoxymethyl)indazol-3-yl]benzoyl]amino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[[4-[1-(2-trimethylsilylethoxymethyl)indazol-3-yl]benzoyl]amino]propyl]carbamate |
|---|---|
| PubChem CID | 54577000 |
| Molecular Formula | C28H40N4O4Si |
| Molecular Weight | 524.74 g/mol |
| Exact Mass | 524.28 |
| IUPAC Name | tert-butyl N-[3-[[4-[1-(2-trimethylsilylethoxymethyl)indazol-3-yl]benzoyl]amino]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCNC(=O)c1ccc(-c2nn(COCC[Si](C)(C)C)c3ccccc23)cc1 |
| InChI | InChI=1S/C28H40N4O4Si/c1-28(2,3)36-27(34)30-17-9-16-29-26(33)22-14-12-21(13-15-22)25-23-10-7-8-11-24(23)32(31-25)20-35-18-19-37(4,5)6/h7-8,10-15H,9,16-20H2,1-6H3,(H,29,33)(H,30,34) |
| InChIKey | PWABGMDBJDPMSC-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 94.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.74 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|