C32H43FN6O4Si — CID 144697790
tert-butyl N-[2-[[4-[5-(2-fluoro-4-methoxy-3-pyridinyl)-1-(2-trimethylsilylethoxymethyl)indazol-3-yl]-2-pyridinyl]-methylamino]ethyl]carbamate (PubChem CID 144697790) has the molecular formula C32H43FN6O4Si and a molecular weight of 622.82 g/mol. Its IUPAC name is tert-butyl N-[2-[[4-[5-(2-fluoro-4-methoxy-3-pyridinyl)-1-(2-trimethylsilylethoxymethyl)indazol-3-yl]-2-pyridinyl]-methylamino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[4-[5-(2-fluoro-4-methoxy-3-pyridinyl)-1-(2-trimethylsilylethoxymethyl)indazol-3-yl]-2-pyridinyl]-methylamino]ethyl]carbamate |
|---|---|
| PubChem CID | 144697790 |
| Molecular Formula | C32H43FN6O4Si |
| Molecular Weight | 622.82 g/mol |
| Exact Mass | 622.31 |
| IUPAC Name | tert-butyl N-[2-[[4-[5-(2-fluoro-4-methoxy-3-pyridinyl)-1-(2-trimethylsilylethoxymethyl)indazol-3-yl]-2-pyridinyl]-methylamino]ethyl]carbamate |
| SMILES | COc1ccnc(F)c1-c1ccc2c(c1)c(-c1ccnc(N(C)CCNC(=O)OC(C)(C)C)c1)nn2COCC[Si](C)(C)C |
| InChI | InChI=1S/C32H43FN6O4Si/c1-32(2,3)43-31(40)36-15-16-38(4)27-20-23(11-13-34-27)29-24-19-22(28-26(41-5)12-14-35-30(28)33)9-10-25(24)39(37-29)21-42-17-18-44(6,7)8/h9-14,19-20H,15-18,21H2,1-8H3,(H,36,40) |
| InChIKey | SCAWPRFWPKIVKD-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 103.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.82 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|