C25H29FN4OSi — CID 90391052
3-(2-fluoro-4-pyridinyl)-N-(3-methylphenyl)-1-(2-trimethylsilylethoxymethyl)indazol-5-amine (PubChem CID 90391052) has the molecular formula C25H29FN4OSi and a molecular weight of 448.62 g/mol. Its IUPAC name is 3-(2-fluoro-4-pyridinyl)-N-(3-methylphenyl)-1-(2-trimethylsilylethoxymethyl)indazol-5-amine.
| Compound Name | 3-(2-fluoro-4-pyridinyl)-N-(3-methylphenyl)-1-(2-trimethylsilylethoxymethyl)indazol-5-amine |
|---|---|
| PubChem CID | 90391052 |
| Molecular Formula | C25H29FN4OSi |
| Molecular Weight | 448.62 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | 3-(2-fluoro-4-pyridinyl)-N-(3-methylphenyl)-1-(2-trimethylsilylethoxymethyl)indazol-5-amine |
| SMILES | Cc1cccc(Nc2ccc3c(c2)c(-c2ccnc(F)c2)nn3COCC[Si](C)(C)C)c1 |
| InChI | InChI=1S/C25H29FN4OSi/c1-18-6-5-7-20(14-18)28-21-8-9-23-22(16-21)25(19-10-11-27-24(26)15-19)29-30(23)17-31-12-13-32(2,3)4/h5-11,14-16,28H,12-13,17H2,1-4H3 |
| InChIKey | YSVHTNLRVQHHDZ-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.62 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|