C27H27N5O4Si — CID 170562660
4-cyano-N-[3-(3-nitrophenyl)-1-(2-trimethylsilylethoxymethyl)indazol-5-yl]benzamide (PubChem CID 170562660) has the molecular formula C27H27N5O4Si and a molecular weight of 513.63 g/mol. Its IUPAC name is 4-cyano-N-[3-(3-nitrophenyl)-1-(2-trimethylsilylethoxymethyl)indazol-5-yl]benzamide.
| Compound Name | 4-cyano-N-[3-(3-nitrophenyl)-1-(2-trimethylsilylethoxymethyl)indazol-5-yl]benzamide |
|---|---|
| PubChem CID | 170562660 |
| Molecular Formula | C27H27N5O4Si |
| Molecular Weight | 513.63 g/mol |
| Exact Mass | 513.18 |
| IUPAC Name | 4-cyano-N-[3-(3-nitrophenyl)-1-(2-trimethylsilylethoxymethyl)indazol-5-yl]benzamide |
| SMILES | C[Si](C)(C)CCOCn1nc(-c2cccc([N+](=O)[O-])c2)c2cc(NC(=O)c3ccc(C#N)cc3)ccc21 |
| InChI | InChI=1S/C27H27N5O4Si/c1-37(2,3)14-13-36-18-31-25-12-11-22(29-27(33)20-9-7-19(17-28)8-10-20)16-24(25)26(30-31)21-5-4-6-23(15-21)32(34)35/h4-12,15-16H,13-14,18H2,1-3H3,(H,29,33) |
| InChIKey | IMXNDUPHCVLFBM-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 123.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.63 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|