C18H22N4O3Si — CID 68672964
trimethyl-[2-[(5-nitro-3-pyridin-4-ylindazol-1-yl)methoxy]ethyl]silane (PubChem CID 68672964) has the molecular formula C18H22N4O3Si and a molecular weight of 370.49 g/mol. Its IUPAC name is trimethyl-[2-[(5-nitro-3-pyridin-4-ylindazol-1-yl)methoxy]ethyl]silane.
| Compound Name | trimethyl-[2-[(5-nitro-3-pyridin-4-ylindazol-1-yl)methoxy]ethyl]silane |
|---|---|
| PubChem CID | 68672964 |
| Molecular Formula | C18H22N4O3Si |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | trimethyl-[2-[(5-nitro-3-pyridin-4-ylindazol-1-yl)methoxy]ethyl]silane |
| SMILES | C[Si](C)(C)CCOCn1nc(-c2ccncc2)c2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C18H22N4O3Si/c1-26(2,3)11-10-25-13-21-17-5-4-15(22(23)24)12-16(17)18(20-21)14-6-8-19-9-7-14/h4-9,12H,10-11,13H2,1-3H3 |
| InChIKey | NCORIFWGBUAZQP-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 83.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|