C15H24N4O2Si — CID 169305279
4-methoxy-3-pyridin-4-yl-1-(2-trimethylsilylethoxymethyl)pyrazol-5-amine (PubChem CID 169305279) has the molecular formula C15H24N4O2Si and a molecular weight of 320.47 g/mol. Its IUPAC name is 4-methoxy-3-pyridin-4-yl-1-(2-trimethylsilylethoxymethyl)pyrazol-5-amine.
| Compound Name | 4-methoxy-3-pyridin-4-yl-1-(2-trimethylsilylethoxymethyl)pyrazol-5-amine |
|---|---|
| PubChem CID | 169305279 |
| Molecular Formula | C15H24N4O2Si |
| Molecular Weight | 320.47 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | 4-methoxy-3-pyridin-4-yl-1-(2-trimethylsilylethoxymethyl)pyrazol-5-amine |
| SMILES | COc1c(-c2ccncc2)nn(COCC[Si](C)(C)C)c1N |
| InChI | InChI=1S/C15H24N4O2Si/c1-20-14-13(12-5-7-17-8-6-12)18-19(15(14)16)11-21-9-10-22(2,3)4/h5-8H,9-11,16H2,1-4H3 |
| InChIKey | JGAWXJVIJYGUHZ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.47 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|