C19H29N3OSi — CID 169122111
4-[5-cyclopropyl-4-methyl-1-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]aniline (PubChem CID 169122111) has the molecular formula C19H29N3OSi and a molecular weight of 343.55 g/mol. Its IUPAC name is 4-[5-cyclopropyl-4-methyl-1-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]aniline.
| Compound Name | 4-[5-cyclopropyl-4-methyl-1-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]aniline |
|---|---|
| PubChem CID | 169122111 |
| Molecular Formula | C19H29N3OSi |
| Molecular Weight | 343.55 g/mol |
| Exact Mass | 343.21 |
| IUPAC Name | 4-[5-cyclopropyl-4-methyl-1-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]aniline |
| SMILES | Cc1c(-c2ccc(N)cc2)nn(COCC[Si](C)(C)C)c1C1CC1 |
| InChI | InChI=1S/C19H29N3OSi/c1-14-18(15-7-9-17(20)10-8-15)21-22(19(14)16-5-6-16)13-23-11-12-24(2,3)4/h7-10,16H,5-6,11-13,20H2,1-4H3 |
| InChIKey | JKOJAVWAGDVSRW-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.55 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|