C18H27N5O2Si — CID 162784324
1-[5-pyridin-4-yl-2-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]piperidin-2-one (PubChem CID 162784324) has the molecular formula C18H27N5O2Si and a molecular weight of 373.53 g/mol. Its IUPAC name is 1-[5-pyridin-4-yl-2-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]piperidin-2-one.
| Compound Name | 1-[5-pyridin-4-yl-2-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]piperidin-2-one |
|---|---|
| PubChem CID | 162784324 |
| Molecular Formula | C18H27N5O2Si |
| Molecular Weight | 373.53 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | 1-[5-pyridin-4-yl-2-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]piperidin-2-one |
| SMILES | C[Si](C)(C)CCOCn1nc(-c2ccncc2)nc1N1CCCCC1=O |
| InChI | InChI=1S/C18H27N5O2Si/c1-26(2,3)13-12-25-14-23-18(22-11-5-4-6-16(22)24)20-17(21-23)15-7-9-19-10-8-15/h7-10H,4-6,11-14H2,1-3H3 |
| InChIKey | ABHKYLVXAXJRON-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 73.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.53 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|