C22H29FN4O4SSi — CID 153356831
5-(4-fluoro-2-propan-2-yl-6-pyridin-4-ylphenoxy)-1-(2-trimethylsilylethoxymethyl)-1,2,4-triazole-3-sulfinic acid (PubChem CID 153356831) has the molecular formula C22H29FN4O4SSi and a molecular weight of 492.65 g/mol. Its IUPAC name is 5-(4-fluoro-2-propan-2-yl-6-pyridin-4-ylphenoxy)-1-(2-trimethylsilylethoxymethyl)-1,2,4-triazole-3-sulfinic acid.
| Compound Name | 5-(4-fluoro-2-propan-2-yl-6-pyridin-4-ylphenoxy)-1-(2-trimethylsilylethoxymethyl)-1,2,4-triazole-3-sulfinic acid |
|---|---|
| PubChem CID | 153356831 |
| Molecular Formula | C22H29FN4O4SSi |
| Molecular Weight | 492.65 g/mol |
| Exact Mass | 492.17 |
| IUPAC Name | 5-(4-fluoro-2-propan-2-yl-6-pyridin-4-ylphenoxy)-1-(2-trimethylsilylethoxymethyl)-1,2,4-triazole-3-sulfinic acid |
| SMILES | CC(C)c1cc(F)cc(-c2ccncc2)c1Oc1nc(S(=O)O)nn1COCC[Si](C)(C)C |
| InChI | InChI=1S/C22H29FN4O4SSi/c1-15(2)18-12-17(23)13-19(16-6-8-24-9-7-16)20(18)31-22-25-21(32(28)29)26-27(22)14-30-10-11-33(3,4)5/h6-9,12-13,15H,10-11,14H2,1-5H3,(H,28,29) |
| InChIKey | YOQBRJMDZAVUON-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 99.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.65 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|