C20H23F2N3O2Si — CID 69023043
6,7-difluoro-5-phenyl-1-(2-trimethylsilylethoxymethyl)indazole-3-carboxamide (PubChem CID 69023043) has the molecular formula C20H23F2N3O2Si and a molecular weight of 403.51 g/mol. Its IUPAC name is 6,7-difluoro-5-phenyl-1-(2-trimethylsilylethoxymethyl)indazole-3-carboxamide.
| Compound Name | 6,7-difluoro-5-phenyl-1-(2-trimethylsilylethoxymethyl)indazole-3-carboxamide |
|---|---|
| PubChem CID | 69023043 |
| Molecular Formula | C20H23F2N3O2Si |
| Molecular Weight | 403.51 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | 6,7-difluoro-5-phenyl-1-(2-trimethylsilylethoxymethyl)indazole-3-carboxamide |
| SMILES | C[Si](C)(C)CCOCn1nc(C(N)=O)c2cc(-c3ccccc3)c(F)c(F)c21 |
| InChI | InChI=1S/C20H23F2N3O2Si/c1-28(2,3)10-9-27-12-25-19-15(18(24-25)20(23)26)11-14(16(21)17(19)22)13-7-5-4-6-8-13/h4-8,11H,9-10,12H2,1-3H3,(H2,23,26) |
| InChIKey | ARJWPPDKWIOWKY-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.51 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|