C16H22BrFN2O2Si — CID 170781316
4-bromo-5-fluoro-2-methyl-1-(2-trimethylsilylethoxymethyl)indole-7-carboxamide (PubChem CID 170781316) has the molecular formula C16H22BrFN2O2Si and a molecular weight of 401.35 g/mol. Its IUPAC name is 4-bromo-5-fluoro-2-methyl-1-(2-trimethylsilylethoxymethyl)indole-7-carboxamide.
| Compound Name | 4-bromo-5-fluoro-2-methyl-1-(2-trimethylsilylethoxymethyl)indole-7-carboxamide |
|---|---|
| PubChem CID | 170781316 |
| Molecular Formula | C16H22BrFN2O2Si |
| Molecular Weight | 401.35 g/mol |
| Exact Mass | 400.06 |
| IUPAC Name | 4-bromo-5-fluoro-2-methyl-1-(2-trimethylsilylethoxymethyl)indole-7-carboxamide |
| SMILES | Cc1cc2c(Br)c(F)cc(C(N)=O)c2n1COCC[Si](C)(C)C |
| InChI | InChI=1S/C16H22BrFN2O2Si/c1-10-7-11-14(17)13(18)8-12(16(19)21)15(11)20(10)9-22-5-6-23(2,3)4/h7-8H,5-6,9H2,1-4H3,(H2,19,21) |
| InChIKey | FDNXSSYTDWCBPI-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 57.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.35 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|