C11H18Cl2N2O2Si — CID 86688715
3,5-dichloro-1-(2-trimethylsilylethoxymethyl)pyrrole-2-carboxamide (PubChem CID 86688715) has the molecular formula C11H18Cl2N2O2Si and a molecular weight of 309.27 g/mol. Its IUPAC name is 3,5-dichloro-1-(2-trimethylsilylethoxymethyl)pyrrole-2-carboxamide.
| Compound Name | 3,5-dichloro-1-(2-trimethylsilylethoxymethyl)pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 86688715 |
| Molecular Formula | C11H18Cl2N2O2Si |
| Molecular Weight | 309.27 g/mol |
| Exact Mass | 308.05 |
| IUPAC Name | 3,5-dichloro-1-(2-trimethylsilylethoxymethyl)pyrrole-2-carboxamide |
| SMILES | C[Si](C)(C)CCOCn1c(Cl)cc(Cl)c1C(N)=O |
| InChI | InChI=1S/C11H18Cl2N2O2Si/c1-18(2,3)5-4-17-7-15-9(13)6-8(12)10(15)11(14)16/h6H,4-5,7H2,1-3H3,(H2,14,16) |
| InChIKey | OFMSWXPMGHTQNP-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 57.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.27 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|