C14H23ClN2O4Si — CID 123838783
6-chloro-4-(oxolan-3-yloxy)-1-(2-trimethylsilylethoxymethyl)pyrimidin-2-one (PubChem CID 123838783) has the molecular formula C14H23ClN2O4Si and a molecular weight of 346.89 g/mol. Its IUPAC name is 6-chloro-4-(oxolan-3-yloxy)-1-(2-trimethylsilylethoxymethyl)pyrimidin-2-one.
| Compound Name | 6-chloro-4-(oxolan-3-yloxy)-1-(2-trimethylsilylethoxymethyl)pyrimidin-2-one |
|---|---|
| PubChem CID | 123838783 |
| Molecular Formula | C14H23ClN2O4Si |
| Molecular Weight | 346.89 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | 6-chloro-4-(oxolan-3-yloxy)-1-(2-trimethylsilylethoxymethyl)pyrimidin-2-one |
| SMILES | C[Si](C)(C)CCOCn1c(Cl)cc(OC2CCOC2)nc1=O |
| InChI | InChI=1S/C14H23ClN2O4Si/c1-22(2,3)7-6-20-10-17-12(15)8-13(16-14(17)18)21-11-4-5-19-9-11/h8,11H,4-7,9-10H2,1-3H3 |
| InChIKey | YSKDIFRANCUDND-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.89 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|