C18H28ClN3O2Si — CID 154698326
6-chloro-N-(oxan-4-yl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-amine (PubChem CID 154698326) has the molecular formula C18H28ClN3O2Si and a molecular weight of 381.98 g/mol. Its IUPAC name is 6-chloro-N-(oxan-4-yl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-amine.
| Compound Name | 6-chloro-N-(oxan-4-yl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-amine |
|---|---|
| PubChem CID | 154698326 |
| Molecular Formula | C18H28ClN3O2Si |
| Molecular Weight | 381.98 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | 6-chloro-N-(oxan-4-yl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-amine |
| SMILES | C[Si](C)(C)CCOCn1ccc2c(NC3CCOCC3)cc(Cl)nc21 |
| InChI | InChI=1S/C18H28ClN3O2Si/c1-25(2,3)11-10-24-13-22-7-4-15-16(12-17(19)21-18(15)22)20-14-5-8-23-9-6-14/h4,7,12,14H,5-6,8-11,13H2,1-3H3,(H,20,21) |
| InChIKey | JACAPIOPRZDYHX-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 48.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.98 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|