C15H25ClN4O3SSi — CID 154698165
2-chloro-N-(2-methylsulfonylethyl)-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 154698165) has the molecular formula C15H25ClN4O3SSi and a molecular weight of 405.00 g/mol. Its IUPAC name is 2-chloro-N-(2-methylsulfonylethyl)-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | 2-chloro-N-(2-methylsulfonylethyl)-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 154698165 |
| Molecular Formula | C15H25ClN4O3SSi |
| Molecular Weight | 405.00 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | 2-chloro-N-(2-methylsulfonylethyl)-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | C[Si](C)(C)CCOCn1ccc2c(NCCS(C)(=O)=O)nc(Cl)nc21 |
| InChI | InChI=1S/C15H25ClN4O3SSi/c1-24(21,22)9-6-17-13-12-5-7-20(14(12)19-15(16)18-13)11-23-8-10-25(2,3)4/h5,7H,6,8-11H2,1-4H3,(H,17,18,19) |
| InChIKey | KBOHPRWFEBHFDC-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.00 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|