C19H26ClN5O3SSi — CID 142339198
2-chloro-8-methyl-N-(2-methylsulfonylphenyl)-9-(2-trimethylsilylethoxymethyl)purin-6-amine (PubChem CID 142339198) has the molecular formula C19H26ClN5O3SSi and a molecular weight of 468.06 g/mol. Its IUPAC name is 2-chloro-8-methyl-N-(2-methylsulfonylphenyl)-9-(2-trimethylsilylethoxymethyl)purin-6-amine.
| Compound Name | 2-chloro-8-methyl-N-(2-methylsulfonylphenyl)-9-(2-trimethylsilylethoxymethyl)purin-6-amine |
|---|---|
| PubChem CID | 142339198 |
| Molecular Formula | C19H26ClN5O3SSi |
| Molecular Weight | 468.06 g/mol |
| Exact Mass | 467.12 |
| IUPAC Name | 2-chloro-8-methyl-N-(2-methylsulfonylphenyl)-9-(2-trimethylsilylethoxymethyl)purin-6-amine |
| SMILES | Cc1nc2c(Nc3ccccc3S(C)(=O)=O)nc(Cl)nc2n1COCC[Si](C)(C)C |
| InChI | InChI=1S/C19H26ClN5O3SSi/c1-13-21-16-17(22-14-8-6-7-9-15(14)29(2,26)27)23-19(20)24-18(16)25(13)12-28-10-11-30(3,4)5/h6-9H,10-12H2,1-5H3,(H,22,23,24) |
| InChIKey | WETFUZWDSZOZSA-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.06 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|