C16H21ClN2O3SSi — CID 87362188
2-[(6-chloro-4-ethynyl-2-methylsulfonylbenzimidazol-1-yl)methoxy]ethyl-trimethylsilane (PubChem CID 87362188) has the molecular formula C16H21ClN2O3SSi and a molecular weight of 384.96 g/mol. Its IUPAC name is 2-[(6-chloro-4-ethynyl-2-methylsulfonylbenzimidazol-1-yl)methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[(6-chloro-4-ethynyl-2-methylsulfonylbenzimidazol-1-yl)methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 87362188 |
| Molecular Formula | C16H21ClN2O3SSi |
| Molecular Weight | 384.96 g/mol |
| Exact Mass | 384.07 |
| IUPAC Name | 2-[(6-chloro-4-ethynyl-2-methylsulfonylbenzimidazol-1-yl)methoxy]ethyl-trimethylsilane |
| SMILES | C#Cc1cc(Cl)cc2c1nc(S(C)(=O)=O)n2COCC[Si](C)(C)C |
| InChI | InChI=1S/C16H21ClN2O3SSi/c1-6-12-9-13(17)10-14-15(12)18-16(23(2,20)21)19(14)11-22-7-8-24(3,4)5/h1,9-10H,7-8,11H2,2-5H3 |
| InChIKey | UTBJWYVABKVJFF-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.96 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|