C24H30Cl2N2O3SSi — CID 131745144
2-[[2,6-dichloro-5-[4-[1-(methylsulfonylmethyl)cyclopropyl]phenyl]pyrrolo[3,2-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 131745144) has the molecular formula C24H30Cl2N2O3SSi and a molecular weight of 525.57 g/mol. Its IUPAC name is 2-[[2,6-dichloro-5-[4-[1-(methylsulfonylmethyl)cyclopropyl]phenyl]pyrrolo[3,2-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[2,6-dichloro-5-[4-[1-(methylsulfonylmethyl)cyclopropyl]phenyl]pyrrolo[3,2-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 131745144 |
| Molecular Formula | C24H30Cl2N2O3SSi |
| Molecular Weight | 525.57 g/mol |
| Exact Mass | 524.11 |
| IUPAC Name | 2-[[2,6-dichloro-5-[4-[1-(methylsulfonylmethyl)cyclopropyl]phenyl]pyrrolo[3,2-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCn1c(Cl)cc2nc(-c3ccc(C4(CS(C)(=O)=O)CC4)cc3)c(Cl)cc21 |
| InChI | InChI=1S/C24H30Cl2N2O3SSi/c1-32(29,30)15-24(9-10-24)18-7-5-17(6-8-18)23-19(25)13-21-20(27-23)14-22(26)28(21)16-31-11-12-33(2,3)4/h5-8,13-14H,9-12,15-16H2,1-4H3 |
| InChIKey | DDKZFINJQKSJJN-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.57 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|