C32H40ClN2O6PSi — CID 154224342
[5-[6-chloro-5-[4-[1-(hydroxymethyl)cyclopropyl]phenyl]-1-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-b]pyridin-2-yl]oxy-2-methylphenyl]-ethoxyphosphinic acid (PubChem CID 154224342) has the molecular formula C32H40ClN2O6PSi and a molecular weight of 643.19 g/mol. Its IUPAC name is [5-[6-chloro-5-[4-[1-(hydroxymethyl)cyclopropyl]phenyl]-1-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-b]pyridin-2-yl]oxy-2-methylphenyl]-ethoxyphosphinic acid.
| Compound Name | [5-[6-chloro-5-[4-[1-(hydroxymethyl)cyclopropyl]phenyl]-1-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-b]pyridin-2-yl]oxy-2-methylphenyl]-ethoxyphosphinic acid |
|---|---|
| PubChem CID | 154224342 |
| Molecular Formula | C32H40ClN2O6PSi |
| Molecular Weight | 643.19 g/mol |
| Exact Mass | 642.21 |
| IUPAC Name | [5-[6-chloro-5-[4-[1-(hydroxymethyl)cyclopropyl]phenyl]-1-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-b]pyridin-2-yl]oxy-2-methylphenyl]-ethoxyphosphinic acid |
| SMILES | CCOP(=O)(O)c1cc(Oc2cc3nc(-c4ccc(C5(CO)CC5)cc4)c(Cl)cc3n2COCC[Si](C)(C)C)ccc1C |
| InChI | InChI=1S/C32H40ClN2O6PSi/c1-6-40-42(37,38)29-17-25(12-7-22(29)2)41-30-19-27-28(35(30)21-39-15-16-43(3,4)5)18-26(33)31(34-27)23-8-10-24(11-9-23)32(20-36)13-14-32/h7-12,17-19,36H,6,13-16,20-21H2,1-5H3,(H,37,38) |
| InChIKey | JCJRESQVEGEDJD-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 103.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.19 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|