C16H22BrClN2O3Si — CID 169003747
ethyl 5-bromo-7-chloro-1-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-b]pyridine-2-carboxylate (PubChem CID 169003747) has the molecular formula C16H22BrClN2O3Si and a molecular weight of 433.81 g/mol. Its IUPAC name is ethyl 5-bromo-7-chloro-1-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-b]pyridine-2-carboxylate.
| Compound Name | ethyl 5-bromo-7-chloro-1-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-b]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 169003747 |
| Molecular Formula | C16H22BrClN2O3Si |
| Molecular Weight | 433.81 g/mol |
| Exact Mass | 432.03 |
| IUPAC Name | ethyl 5-bromo-7-chloro-1-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-b]pyridine-2-carboxylate |
| SMILES | CCOC(=O)c1cc2nc(Br)cc(Cl)c2n1COCC[Si](C)(C)C |
| InChI | InChI=1S/C16H22BrClN2O3Si/c1-5-23-16(21)13-9-12-15(11(18)8-14(17)19-12)20(13)10-22-6-7-24(2,3)4/h8-9H,5-7,10H2,1-4H3 |
| InChIKey | DBAQLAQKDYFWDL-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.81 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|