C15H22BrNO4Si — CID 178180599
ethyl 3-bromo-4-(2-trimethylsilylethoxymethyl)furo[3,2-b]pyrrole-5-carboxylate (PubChem CID 178180599) has the molecular formula C15H22BrNO4Si and a molecular weight of 388.33 g/mol. Its IUPAC name is ethyl 3-bromo-4-(2-trimethylsilylethoxymethyl)furo[3,2-b]pyrrole-5-carboxylate.
| Compound Name | ethyl 3-bromo-4-(2-trimethylsilylethoxymethyl)furo[3,2-b]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 178180599 |
| Molecular Formula | C15H22BrNO4Si |
| Molecular Weight | 388.33 g/mol |
| Exact Mass | 387.05 |
| IUPAC Name | ethyl 3-bromo-4-(2-trimethylsilylethoxymethyl)furo[3,2-b]pyrrole-5-carboxylate |
| SMILES | CCOC(=O)c1cc2occ(Br)c2n1COCC[Si](C)(C)C |
| InChI | InChI=1S/C15H22BrNO4Si/c1-5-20-15(18)12-8-13-14(11(16)9-21-13)17(12)10-19-6-7-22(2,3)4/h8-9H,5-7,10H2,1-4H3 |
| InChIKey | UDNWIZHBCVZIHJ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 53.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.33 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|