C17H24N2O6 — CID 50924880
ethyl 4-[2-[(2R)-2-amino-3-methylbutanoyl]oxyethoxymethyl]furo[3,2-b]pyrrole-5-carboxylate (PubChem CID 50924880) has the molecular formula C17H24N2O6 and a molecular weight of 352.39 g/mol. Its IUPAC name is ethyl 4-[2-[(2R)-2-amino-3-methylbutanoyl]oxyethoxymethyl]furo[3,2-b]pyrrole-5-carboxylate.
| Compound Name | ethyl 4-[2-[(2R)-2-amino-3-methylbutanoyl]oxyethoxymethyl]furo[3,2-b]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 50924880 |
| Molecular Formula | C17H24N2O6 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | ethyl 4-[2-[(2R)-2-amino-3-methylbutanoyl]oxyethoxymethyl]furo[3,2-b]pyrrole-5-carboxylate |
| SMILES | CCOC(=O)c1cc2occc2n1COCCOC(=O)[C@H](N)C(C)C |
| InChI | InChI=1S/C17H24N2O6/c1-4-23-16(20)13-9-14-12(5-6-24-14)19(13)10-22-7-8-25-17(21)15(18)11(2)3/h5-6,9,11,15H,4,7-8,10,18H2,1-3H3/t15-/m1/s1 |
| InChIKey | HOPAIOPLNGUDSA-OAHLLOKOSA-N |
| XLogP | 1.91 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|